CymitQuimica logo

CAS 144345-38-0

:

1,2-Pyrrolidinedicarboxylic acid, 4-methyl-5-oxo-, bis(1,1-dimethylethyl)ester, (2S,4S)-

Description:
1,2-Pyrrolidinedicarboxylic acid, 4-methyl-5-oxo-, bis(1,1-dimethylethyl)ester, (2S,4S)-, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple carboxylic acid functional groups. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. The presence of the bis(1,1-dimethylethyl)ester moiety suggests that it has significant steric hindrance, which can influence its reactivity and solubility. The (2S,4S) designation indicates specific stereochemistry, which is crucial for its biological activity and interaction with other molecules. Generally, compounds of this nature may exhibit properties such as moderate to high polarity, potential for hydrogen bonding due to the carboxylic acid groups, and varying degrees of stability depending on environmental conditions. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C15H25NO5
InChI:InChI=1S/C15H25NO5/c1-9-8-10(12(18)20-14(2,3)4)16(11(9)17)13(19)21-15(5,6)7/h9-10H,8H2,1-7H3/t9-,10-/m0/s1
InChI key:DABCKYVCUIIEGB-UWVGGRQHSA-N
SMILES:C[C@H]1C[C@H](N(C1=O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C
Found 2 products.