CAS 14437-41-3
:2-(Acetyloxy)-N-(4-chlorophenyl)-3,5-diiodobenzamide
Description:
2-(Acetyloxy)-N-(4-chlorophenyl)-3,5-diiodobenzamide, identified by its CAS number 14437-41-3, is a chemical compound that features a complex structure characterized by the presence of multiple functional groups. It contains an acetyloxy group, which contributes to its reactivity and solubility properties. The compound also includes a benzamide moiety, indicating potential applications in pharmaceuticals or agrochemicals due to its ability to interact with biological systems. The presence of two iodine atoms on the benzene ring enhances its lipophilicity and may influence its biological activity, while the 4-chlorophenyl group can affect its electronic properties and reactivity. Overall, this compound's unique combination of halogen substituents and functional groups suggests potential utility in medicinal chemistry, particularly in the development of compounds with specific biological activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further explored through various analytical methods to assess its stability, solubility, and reactivity.
Formula:C15H10ClI2NO3
InChI:InChI=1S/C15H10ClI2NO3/c1-8(20)22-14-12(6-10(17)7-13(14)18)15(21)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,21)
InChI key:InChIKey=ICKMASVVMCGZLR-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Cl)C=C1)(=O)C2=C(OC(C)=O)C(I)=CC(I)=C2
Synonyms:- 2-Acetoxy-4′-chloro-3,5-diiodobenzanilide
- 4′-Chloro-3,5-diiodosalicylanilide acetate
- benzamide, 2-(acetyloxy)-N-(4-chlorophenyl)-3,5-diiodo-
- 2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl acetate
- 238-414-0
- 2-(Acetyloxy)-N-(4-chlorophenyl)-3,5-diiodobenzamide
- Salicylanilide, 4′-chloro-3,5-diiodo-, acetate (ester)
- Benzamide, 2-(acetyloxy)-N-(4-chlorophenyl)-3,5-diiodo-
- 2-[(4-Chlorphenyl)carbamoyl]-4,6-diiodphenylacetat
- 14437-41-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Clioxanide
CAS:<p>Clioxanide is an anthelmintic agent.</p>Formula:C15H10ClI2NO3Color and Shape:SolidMolecular weight:541.51
