CymitQuimica logo

CAS 144386-82-3

:

2-Nitro-7-fluoranthenol

Description:
2-Nitro-7-fluoranthenol is an organic compound characterized by its unique structure, which includes a nitro group and a hydroxyl group attached to a fluoranthene backbone. This compound is part of the polycyclic aromatic hydrocarbons (PAHs) family, known for their complex ring structures and potential biological activity. The presence of the nitro group introduces polar characteristics, which can influence its solubility and reactivity. Typically, compounds like 2-Nitro-7-fluoranthenol may exhibit fluorescence properties, making them of interest in various applications, including materials science and organic electronics. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. Due to its structural features, this compound may also be studied for its potential environmental impact and toxicity, as many nitro-substituted PAHs are known to have harmful effects. Overall, 2-Nitro-7-fluoranthenol represents a significant area of interest in both synthetic and applied chemistry.
Formula:C16H9NO3
InChI:InChI=1/C16H9NO3/c18-14-6-2-4-11-13-8-10(17(19)20)7-9-3-1-5-12(15(9)13)16(11)14/h1-8,18H
SMILES:c1cc2cc(cc3c4cccc(c4c(c1)c23)O)N(=O)=O
Synonyms:
  • 7-Hydroxy-2-nitrofluoranthene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.