CAS 1443931-91-6

Benzenemethanamine, 2-bromo-4-methoxy-α-methyl-, hydrochloride (1:1), (αR)-

Description:

Benzenemethanamine, 2-bromo-4-methoxy-α-methyl-, hydrochloride (1:1), (αR)- is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a bromine atom and a methoxy group, along with an α-methyl group attached to the amine. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, including pharmaceutical research. The presence of the bromine and methoxy substituents can influence the compound's reactivity, polarity, and biological activity. As an amine, it may participate in hydrogen bonding, affecting its interaction with biological targets. The (αR)- designation indicates a specific stereochemistry, which can be crucial for its pharmacological properties. Overall, this compound is of interest in medicinal chemistry and may be studied for its potential therapeutic effects or as a precursor in the synthesis of more complex molecules.

Formula: C₉H₁₂BrNO·ClH

InChI: InChI=1S/C9H12BrNO.ClH/c1-6(11)8-4-3-7(12-2)5-9(8)10;/h3-6H,11H2,1-2H3;1H/t6-;/m1./s1

InChI key: InChIKey=XSPJNVXQPPZCEM-FYZOBXCZSA-N

SMILES: [C@H](C)(N)C1=C(Br)C=C(OC)C=C1.Cl

Synonyms:

• Benzenemethanamine, 2-bromo-4-methoxy-α-methyl-, hydrochloride (1:1), (αR)-

(1R)-1-(2-Bromo-4-methoxyphenyl)ethan-1-amine hydrochloride

CAS: 1443931-91-6

Versatile small molecule scaffold

Formula: C₉H₁₃BrClNO

Purity: Min. 95%

Molecular weight: 266.56 g/mol

Ref: 3D-THC93191