CAS 1443979-63-2

2,3-Dihydro-4-methoxy-2-benzofuranacetonitrile

Description:

2,3-Dihydro-4-methoxy-2-benzofuranacetonitrile is a chemical compound characterized by its unique structural features, which include a benzofuran moiety and a nitrile functional group. This compound typically exhibits a molecular structure that combines a furan ring with a methoxy group and an acetonitrile substituent, contributing to its potential reactivity and interactions. The presence of the methoxy group can influence its solubility and polarity, while the nitrile group may impart specific chemical properties, such as the ability to participate in nucleophilic reactions. In terms of physical properties, compounds of this nature often have moderate to low volatility and may be soluble in organic solvents. The compound's applications could span various fields, including pharmaceuticals and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with safety regulations.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1S/C11H11NO2/c1-13-10-3-2-4-11-9(10)7-8(14-11)5-6-12/h2-4,8H,5,7H2,1H3

InChI key: InChIKey=CLVGBWZRFVMNPB-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(OC(CC#N)C2)=CC=C1

Synonyms:

• 2-Benzofuranacetonitrile, 2,3-dihydro-4-methoxy-
• 2,3-Dihydro-4-methoxy-2-benzofuranacetonitrile

2-(4-Methoxy-2,3-dihydro-1-benzofuran-2-yl)acetonitrile

CAS: 1443979-63-2

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-THC97963