CAS 1443979-66-5

1-Piperidineethanol, 3-(1-aminoethyl)-α,α-dimethyl-, hydrochloride (1:2)

Description:

1-Piperidineethanol, 3-(1-aminoethyl)-α,α-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethanolamine structure, which contributes to its potential biological activity. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its polar nature due to the presence of hydroxyl and amine functional groups. The hydrochloride salt form enhances its stability and solubility, making it suitable for various applications, particularly in pharmaceutical formulations. The compound may exhibit properties related to neurotransmitter modulation, given its structural similarity to other amine-containing compounds. Its molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic uses. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies. As with any chemical, proper handling and safety protocols should be observed, especially in laboratory settings.

Formula: C₁₁H₂₄N₂O·2ClH

InChI: InChI=1S/C11H24N2O.2ClH/c1-9(12)10-5-4-6-13(7-10)8-11(2,3)14;;/h9-10,14H,4-8,12H2,1-3H3;2*1H

InChI key: InChIKey=MHWVILDVOIFEBV-UHFFFAOYSA-N

SMILES: C(C(C)(C)O)N1CC(C(C)N)CCC1.Cl

Synonyms:

• 1-Piperidineethanol, 3-(1-aminoethyl)-α,α-dimethyl-, hydrochloride (1:2)

1-[3-(1-Aminoethyl)piperidin-1-yl]-2-methylpropan-2-ol dihydrochloride

CAS: 1443979-66-5

Versatile small molecule scaffold

Formula: C₁₁H₂₆Cl₂N₂O

Purity: Min. 95%

Molecular weight: 273.24 g/mol

Ref: 3D-THC97966