CAS 1443979-75-6

2H-Pyran-3-acetic acid, α-aminotetrahydro-, ethyl ester, hydrochloride (1:1)

Description:

2H-Pyran-3-acetic acid, α-aminotetrahydro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which contributes to its reactivity and potential biological activity. This compound features an acetic acid moiety and an ethyl ester group, indicating it may exhibit properties typical of esters, such as solubility in organic solvents and potential for hydrolysis. The presence of the α-amino group suggests that it may participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. The hydrochloride salt form indicates that it is a protonated species, which can enhance its solubility in water and influence its pharmacokinetic properties. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to interactions with biological targets. Overall, its unique combination of functional groups and structural characteristics positions it as a potentially valuable compound in research and development contexts.

Formula: C₉H₁₇NO₃·ClH

InChI: InChI=1S/C9H17NO3.ClH/c1-2-13-9(11)8(10)7-4-3-5-12-6-7;/h7-8H,2-6,10H2,1H3;1H

InChI key: InChIKey=LFWIUCMLAAXZHF-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(N)C1CCCOC1.Cl

Synonyms:

• 2H-Pyran-3-acetic acid, α-aminotetrahydro-, ethyl ester, hydrochloride (1:1)

Ethyl 2-amino-2-(oxan-3-yl)acetate hydrochloride

CAS: 1443979-75-6

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 223.7 g/mol

Ref: 3D-THC97975