CAS 1443979-99-4

1,1-Dimethylethyl 3-fluoro-3-(2-fluorophenyl)-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-fluoro-3-(2-fluorophenyl)-1-azetidinecarboxylate is a chemical compound characterized by its unique structure, which includes an azetidine ring, a carboxylate functional group, and multiple fluorine substituents. The presence of the dimethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological targets. The fluorine atoms enhance the compound's lipophilicity and may affect its pharmacokinetic properties, making it of interest in medicinal chemistry. This compound's azetidine structure suggests potential applications in the development of pharmaceuticals, particularly in the design of novel agents with specific biological activities. Its molecular characteristics, including molecular weight and solubility, would be essential for understanding its behavior in various chemical environments. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the fluorine atoms and the overall steric environment created by the substituents. Overall, this compound represents a complex and potentially valuable structure in the field of organic chemistry and drug development.

Formula: C₁₄H₁₇F₂NO₂

InChI: InChI=1S/C14H17F2NO2/c1-13(2,3)19-12(18)17-8-14(16,9-17)10-6-4-5-7-11(10)15/h4-7H,8-9H2,1-3H3

InChI key: InChIKey=SRLBUIWEWKPCRG-UHFFFAOYSA-N

SMILES: FC1(C2=C(F)C=CC=C2)CN(C(OC(C)(C)C)=O)C1

Synonyms:

• 1-Azetidinecarboxylic acid, 3-fluoro-3-(2-fluorophenyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-fluoro-3-(2-fluorophenyl)-1-azetidinecarboxylate

tert-Butyl 3-fluoro-3-(2-fluorophenyl)azetidine-1-carboxylate

CAS: 1443979-99-4

Versatile small molecule scaffold

Formula: C₁₄H₁₇F₂NO₂

Purity: Min. 95%

Molecular weight: 269.29 g/mol

Ref: 3D-THC97999