CAS 1443980-02-6

Piperidine, 4-(4-chloro-1H-pyrazol-1-yl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(4-chloro-1H-pyrazol-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 4-chloro-1H-pyrazole substituent introduces additional reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential intermediate in organic synthesis or possessing specific pharmacological activities, although detailed biological data would be necessary to confirm such effects. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₂ClN₃·ClH

InChI: InChI=1S/C8H12ClN3.ClH/c9-7-5-11-12(6-7)8-1-3-10-4-2-8;/h5-6,8,10H,1-4H2;1H

InChI key: InChIKey=FVUGWEMWJJQHRK-UHFFFAOYSA-N

SMILES: ClC1=CN(N=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(4-chloro-1H-pyrazol-1-yl)-, hydrochloride (1:1)

4-(4-Chloro-1H-pyrazol-1-yl)piperidine hydrochloride

CAS: 1443980-02-6

Versatile small molecule scaffold

Formula: C₈H₁₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 222.11 g/mol

Ref: 3D-THC98002