CAS 1443980-46-8

Methyl 6-[[(cyclopropylcarbonyl)amino]methyl]-2-methyl-3-pyridinecarboxylate

Description:

Methyl 6-[[(cyclopropylcarbonyl)amino]methyl]-2-methyl-3-pyridinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methyl ester functional group, and a cyclopropylcarbonyl moiety. This compound features a pyridine backbone that contributes to its aromatic properties, while the presence of the methyl ester enhances its solubility in organic solvents. The cyclopropylcarbonyl group introduces unique steric and electronic effects, potentially influencing the compound's reactivity and interaction with biological targets. The amino group linked to the cyclopropylcarbonyl adds to the compound's functionality, making it a candidate for various chemical reactions, including amide formation and nucleophilic substitutions. Due to its structural features, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical determination or literature reference for precise values. Overall, this compound represents a unique blend of structural elements that could be explored for various applications in chemical and pharmaceutical research.

Formula: C₁₃H₁₆N₂O₃

InChI: InChI=1S/C13H16N2O3/c1-8-11(13(17)18-2)6-5-10(15-8)7-14-12(16)9-3-4-9/h5-6,9H,3-4,7H2,1-2H3,(H,14,16)

InChI key: InChIKey=CKIWJAIJOOHLRA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C)N=C(CNC(=O)C2CC2)C=C1

Synonyms:

• Methyl 6-[[(cyclopropylcarbonyl)amino]methyl]-2-methyl-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 6-[[(cyclopropylcarbonyl)amino]methyl]-2-methyl-, methyl ester

Methyl 6-[(cyclopropylformamido)methyl]-2-methylpyridine-3-carboxylate

CAS: 1443980-46-8

Versatile small molecule scaffold

Formula: C₁₃H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 248.28 g/mol

Ref: 3D-THC98046