CAS 1443980-51-5

4-Pyridazinamine, 3-methyl-, hydrochloride (1:1)

Description:

4-Pyridazinamine, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl group at the 3-position and an amino group at the 4-position of the pyridazine ring, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water, making it suitable for various applications in pharmaceuticals and research. The presence of the hydrochloride indicates that the compound can exist in a protonated form, which may influence its biological activity and interaction with other molecules. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Overall, 4-Pyridazinamine, 3-methyl-, hydrochloride is of interest in medicinal chemistry, particularly for its potential use in drug development and synthesis.

Formula: C₅H₇N₃·ClH

InChI: InChI=1S/C5H7N3.ClH/c1-4-5(6)2-3-7-8-4;/h2-3H,1H3,(H2,6,7);1H

InChI key: InChIKey=AAQJYQRQAUSXSZ-UHFFFAOYSA-N

SMILES: NC1=C(C)N=NC=C1.Cl

Synonyms:

• 4-Pyridazinamine, 3-methyl-, hydrochloride (1:1)
• 3-Methylpyridazin-4-amine hydrochloride

3-METHYLPYRIDAZIN-4-AMINE HCL

CAS: 1443980-51-5

Formula: C₅H₈ClN₃

Purity: 95.0%

Molecular weight: 145.59

Ref: 10-F527794

3-Methylpyridazin-4-amine hydrochloride

CAS: 1443980-51-5

Versatile small molecule scaffold

Formula: C₅H₈ClN₃

Purity: Min. 95%

Molecular weight: 145.59 g/mol

Ref: 3D-THC98051