CAS 1443980-58-2

Acetamide, 2-chloro-N-[4-(4-morpholinyl)phenyl]-, hydrochloride (1:1)

Description:

Acetamide, 2-chloro-N-[4-(4-morpholinyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical agent. The presence of a chloro substituent and a morpholine ring suggests that it may exhibit specific biological activities, possibly related to its interaction with various receptors or enzymes. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for medicinal applications. The compound's molecular structure implies it may possess properties such as moderate polarity and the ability to form hydrogen bonds, which can influence its pharmacokinetics and pharmacodynamics. Additionally, the presence of the morpholine moiety may contribute to its lipophilicity, affecting its distribution within biological systems. Overall, this compound's unique structural features suggest potential utility in drug development, particularly in areas requiring targeted therapeutic action. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₂H₁₅ClN₂O₂·ClH

InChI: InChI=1S/C12H15ClN2O2.ClH/c13-9-12(16)14-10-1-3-11(4-2-10)15-5-7-17-8-6-15;/h1-4H,5-9H2,(H,14,16);1H

InChI key: InChIKey=XWMDAKHLVAIYGS-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=CC=C(C=C1)N2CCOCC2.Cl

Synonyms:

• Acetamide, 2-chloro-N-[4-(4-morpholinyl)phenyl]-, hydrochloride (1:1)

2-Chloro-N-[4-(morpholin-4-yl)phenyl]acetamide hydrochloride

CAS: 1443980-58-2

Versatile small molecule scaffold

Formula: C₁₂H₁₆Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 291.17 g/mol

Ref: 3D-THC98058