CAS 1443980-65-1

4-(1,1-Dimethylethyl) 2-cyano-2-methylbutanedioate

Description:

4-(1,1-Dimethylethyl) 2-cyano-2-methylbutanedioate, identified by its CAS number 1443980-65-1, is an organic compound characterized by its unique structure that includes a cyano group and a diester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, which makes it useful in various chemical applications. The presence of the cyano group imparts notable reactivity, allowing it to participate in nucleophilic addition reactions, while the diester moiety contributes to its potential as a building block in organic synthesis. Additionally, the bulky tert-butyl group enhances its steric properties, influencing its reactivity and interactions with other molecules. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose health and environmental risks if not managed properly.

Formula: C₁₀H₁₅NO₄

InChI: InChI=1S/C10H15NO4/c1-9(2,3)15-7(12)5-10(4,6-11)8(13)14/h5H2,1-4H3,(H,13,14)

InChI key: InChIKey=MIRBMHHZLRQLQM-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)(C#N)C)C(OC(C)(C)C)=O

Synonyms:

• Butanedioic acid, 2-cyano-2-methyl-, 4-(1,1-dimethylethyl) ester
• 4-(1,1-Dimethylethyl) 2-cyano-2-methylbutanedioate

4-(tert-Butoxy)-2-cyano-2-methyl-4-oxobutanoic acid

CAS: 1443980-65-1

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO₄

Purity: 90%Min

Molecular weight: 213.23 g/mol

Ref: 3D-THC98065