CAS 1443980-86-6

Glycine, N-(hydrazinylcarbonyl)-, methyl ester, hydrochloride (1:1)

Description:

Glycine, N-(hydrazinylcarbonyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a glycine backbone modified with a hydrazinylcarbonyl group and a methyl ester functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in biochemical and pharmaceutical contexts. The presence of the hydrazine moiety suggests potential reactivity, particularly in condensation reactions or as a precursor in the synthesis of more complex molecules. Glycine itself is the simplest amino acid, and its derivatives often exhibit interesting biological activities, making this compound of interest in medicinal chemistry. Additionally, the methyl ester form can influence the compound's pharmacokinetics and bioavailability. As with many hydrazine derivatives, caution is advised due to potential toxicity and reactivity, particularly in the presence of strong oxidizing agents. Overall, this compound represents a unique intersection of amino acid chemistry and hydrazine chemistry, with potential applications in drug development and synthesis.

Formula: C₄H₉N₃O₃·ClH

InChI: InChI=1S/C4H9N3O3.ClH/c1-10-3(8)2-6-4(9)7-5;/h2,5H2,1H3,(H2,6,7,9);1H

InChI key: InChIKey=CZNPWKAKPLAREO-UHFFFAOYSA-N

SMILES: C(CNC(NN)=O)(OC)=O.Cl

Synonyms:

• Glycine, N-(hydrazinylcarbonyl)-, methyl ester, hydrochloride (1:1)

Methyl 2-[(hydrazinecarbonyl)amino]acetate hydrochloride

CAS: 1443980-86-6

Versatile small molecule scaffold

Formula: C₄H₁₀ClN₃O₃

Purity: Min. 95%

Molecular weight: 183.59 g/mol

Ref: 3D-THC98086