CAS 1443981-06-3

1,1-Dimethylethyl N-[1-(4-cyclopropylphenyl)ethyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(4-cyclopropylphenyl)ethyl]carbamate, identified by its CAS number 1443981-06-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a tert-butyl group (1,1-dimethylethyl) and a cyclopropyl-substituted phenyl moiety, which contributes to its unique properties. Carbamates are known for their applications in agriculture as pesticides and herbicides, as well as in pharmaceuticals. The presence of the cyclopropyl group may enhance the compound's biological activity and specificity. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular architecture. While specific physical and chemical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high lipophilicity, which can affect their bioavailability and environmental persistence. Understanding the characteristics of this compound is essential for its potential applications in various fields, including agrochemistry and medicinal chemistry.

Formula: C₁₆H₂₃NO₂

InChI: InChI=1S/C16H23NO2/c1-11(17-15(18)19-16(2,3)4)12-5-7-13(8-6-12)14-9-10-14/h5-8,11,14H,9-10H2,1-4H3,(H,17,18)

InChI key: InChIKey=OOLVDDHJQZDXQB-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(C)C1=CC=C(C2CC2)C=C1

Synonyms:

• Carbamic acid, N-[1-(4-cyclopropylphenyl)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-(4-cyclopropylphenyl)ethyl]carbamate

tert-Butyl N-[1-(4-cyclopropylphenyl)ethyl]carbamate

CAS: 1443981-06-3

Versatile small molecule scaffold

Formula: C₁₆H₂₃NO₂

Purity: Min. 95%

Molecular weight: 261.36 g/mol

Ref: 3D-THC98106