CAS 1443981-10-9

1,4-Dioxino[2,3-g]isoquinoline, 2,3,6,7,8,9-hexahydro-, hydrochloride (1:1)

Description:

1,4-Dioxino[2,3-g]isoquinoline, 2,3,6,7,8,9-hexahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure that incorporates both dioxin and isoquinoline moieties. This compound features a hexahydro configuration, indicating the presence of multiple saturated carbon rings, which contributes to its stability and potential biological activity. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride indicates that the compound can exist in a protonated state, which may influence its reactivity and interaction with biological targets. As a relatively complex organic molecule, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Its CAS number, 1443981-10-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in research and industry.

Formula: C₁₁H₁₃NO₂·ClH

InChI: InChI=1S/C11H13NO2.ClH/c1-2-12-7-9-6-11-10(5-8(1)9)13-3-4-14-11;/h5-6,12H,1-4,7H2;1H

InChI key: InChIKey=LRJZGBXWGFSKHV-UHFFFAOYSA-N

SMILES: C=12C(=CC3=C(C1)OCCO3)CNCC2.Cl

Synonyms:

• 1,4-Dioxino[2,3-g]isoquinoline, 2,3,6,7,8,9-hexahydro-, hydrochloride (1:1)

2H,3H,6H,7H,8H,9H-[1,4]Dioxino[2,3-G]isoquinoline hydrochloride

CAS: 1443981-10-9

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-THC98110