CAS 1443981-14-3

2-[2-(Dimethylamino)-2-oxoethoxy]-α,α-difluorobenzeneacetic acid

Description:

2-[2-(Dimethylamino)-2-oxoethoxy]-α,α-difluorobenzeneacetic acid, identified by its CAS number 1443981-14-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a difluorobenzene moiety and a dimethylamino group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the dimethylamino group, respectively. It is likely to be soluble in polar solvents, given the presence of the polar functional groups. The difluorobenzene component may impart unique electronic properties, potentially influencing its reactivity and interactions with biological targets. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific applications and biological activities would depend on further empirical studies, including its pharmacokinetics, toxicity, and mechanism of action. Overall, the compound represents a class of molecules that could have significant implications in various chemical and biological contexts.

Formula: C₁₂H₁₃F₂NO₄

InChI: InChI=1S/C12H13F2NO4/c1-15(2)10(16)7-19-9-6-4-3-5-8(9)12(13,14)11(17)18/h3-6H,7H2,1-2H3,(H,17,18)

InChI key: InChIKey=VZLVQFXGPOEBTM-UHFFFAOYSA-N

SMILES: C(C(O)=O)(F)(F)C1=C(OCC(N(C)C)=O)C=CC=C1

Synonyms:

• Benzeneacetic acid, 2-[2-(dimethylamino)-2-oxoethoxy]-α,α-difluoro-
• 2-[2-(Dimethylamino)-2-oxoethoxy]-α,α-difluorobenzeneacetic acid

2-{2-[(Dimethylcarbamoyl)methoxy]phenyl}-2,2-difluoroacetic acid

CAS: 1443981-14-3

Versatile small molecule scaffold

Formula: C₁₂H₁₃F₂NO₄

Purity: Min. 95%

Molecular weight: 273.23 g/mol

Ref: 3D-THC98114