CAS 1443981-28-9

3-Methyl-N-(phenylmethyl)-α-(trifluoromethyl)benzenemethanamine

Description:

3-Methyl-N-(phenylmethyl)-α-(trifluoromethyl)benzenemethanamine, identified by its CAS number 1443981-28-9, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a trifluoromethyl group, which is known for its influence on the compound's electronic properties and lipophilicity. The presence of the methyl group and the phenylmethyl substituent contributes to its steric and electronic characteristics, potentially affecting its reactivity and interaction with biological systems. The trifluoromethyl group can enhance the compound's stability and alter its solubility in various solvents. As with many amines, it may exhibit basic properties and can participate in hydrogen bonding, which can influence its behavior in chemical reactions and interactions with other molecules. The specific applications and biological activity of this compound would depend on its unique structural features, making it of interest in fields such as medicinal chemistry and materials science. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₆H₁₆F₃N

InChI: InChI=1S/C16H16F3N/c1-12-6-5-9-14(10-12)15(16(17,18)19)20-11-13-7-3-2-4-8-13/h2-10,15,20H,11H2,1H3

InChI key: InChIKey=CNJZKDUVKMICNI-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)(C(F)(F)F)C2=CC(C)=CC=C2

Synonyms:

• Benzenemethanamine, 3-methyl-N-(phenylmethyl)-α-(trifluoromethyl)-
• 3-Methyl-N-(phenylmethyl)-α-(trifluoromethyl)benzenemethanamine

Benzyl[2,2,2-trifluoro-1-(3-methylphenyl)ethyl]amine

CAS: 1443981-28-9

Versatile small molecule scaffold

Formula: C₁₆H₁₆F₃N

Purity: Min. 95%

Molecular weight: 279.3 g/mol

Ref: 3D-THC98128