CAS 1443981-39-2

4-[4-[(Methylamino)methyl]-2-oxazolyl]benzonitrile

Description:

4-[4-[(Methylamino)methyl]-2-oxazolyl]benzonitrile, identified by its CAS number 1443981-39-2, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and an oxazole ring. This compound features a methylamino group that is attached to a methylene bridge, linking it to the oxazole ring, which contributes to its potential biological activity. The presence of the nitrile group indicates that it may exhibit polar characteristics, influencing its solubility and reactivity. The oxazole ring is known for its role in various pharmacological activities, suggesting that this compound may have applications in medicinal chemistry. Additionally, the compound's structural features may allow for interactions with biological targets, making it of interest in drug discovery and development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through spectroscopic methods and biological assays to assess its efficacy and safety in potential applications.

Formula: C₁₂H₁₁N₃O

InChI: InChI=1S/C12H11N3O/c1-14-7-11-8-16-12(15-11)10-4-2-9(6-13)3-5-10/h2-5,8,14H,7H2,1H3

InChI key: InChIKey=PGSYWTCBZRNDEL-UHFFFAOYSA-N

SMILES: C(NC)C=1N=C(OC1)C2=CC=C(C#N)C=C2

Synonyms:

• Benzonitrile, 4-[4-[(methylamino)methyl]-2-oxazolyl]-
• 4-[4-[(Methylamino)methyl]-2-oxazolyl]benzonitrile

4-{4-[(Methylamino)methyl]-1,3-oxazol-2-yl}benzonitrile

CAS: 1443981-39-2

Versatile small molecule scaffold

Formula: C₁₂H₁₁N₃O

Purity: Min. 95%

Molecular weight: 213.23 g/mol

Ref: 3D-THC98139