CAS 1443981-50-7

1,3,4-Oxadiazole-2-methanol, α,5-dimethyl-, 2-acetate

Description:

1,3,4-Oxadiazole-2-methanol, α,5-dimethyl-, 2-acetate is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanol group and an acetate moiety, contributing to its solubility and reactivity. The presence of the α,5-dimethyl substituents indicates that there are two methyl groups attached to the oxadiazole ring, which can influence its physical and chemical properties, such as boiling point, melting point, and polarity. The oxadiazole derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory properties. The acetate group can enhance the compound's lipophilicity, potentially affecting its pharmacokinetics and bioavailability. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals and materials science, although specific applications would depend on further research and characterization.

Formula: C₇H₁₀N₂O₃

InChI: InChI=1S/C7H10N2O3/c1-4(11-6(3)10)7-9-8-5(2)12-7/h4H,1-3H3

InChI key: InChIKey=CIUSQRANEWPBHJ-UHFFFAOYSA-N

SMILES: C(OC(C)=O)(C)C=1OC(C)=NN1

Synonyms:

• 1,3,4-Oxadiazole-2-methanol, α,5-dimethyl-, 2-acetate

1-(5-Methyl-1,3,4-oxadiazol-2-yl)ethyl acetate

CAS: 1443981-50-7

Versatile small molecule scaffold

Formula: C₇H₁₀N₂O₃

Purity: Min. 95%

Molecular weight: 170.17 g/mol

Ref: 3D-THC98150