CAS 1443981-59-6

[1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid, hydrochloride (1:1)

Description:

[1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid, hydrochloride (1:1), is a chemical compound characterized by its triazole and pyridine ring structures, which contribute to its unique chemical properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for diverse applications in pharmaceutical and biochemical research. The presence of the carboxylic acid functional group enhances its acidity and potential for forming salts, while the hydrochloride form indicates the presence of hydrochloric acid, which can improve solubility and stability. This compound may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in the fields of anti-inflammatory or antimicrobial agents. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to potential toxicity or reactivity.

Formula: C₇H₅N₃O₂·ClH

InChI: InChI=1S/C7H5N3O2.ClH/c11-7(12)5-2-1-3-6-8-4-9-10(5)6;/h1-4H,(H,11,12);1H

InChI key: InChIKey=KKZVWAOOZGZOFX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC=N2)C=CC1.Cl

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid, hydrochloride (1:1)

[1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid hydrochloride

CAS: 1443981-59-6

Versatile small molecule scaffold

Formula: C₇H₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 199.59 g/mol

Ref: 3D-THC98159