CAS 1443981-73-4

Benzenemethanamine, 3,4,5-trimethoxy-α-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3,4,5-trimethoxy-α-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1443981-73-4, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with multiple functional groups. The presence of three methoxy groups (–OCH3) at the 3, 4, and 5 positions of the benzene ring enhances its electron-donating properties, potentially influencing its reactivity and solubility. The α-(trifluoromethyl) group (–CF3) introduces significant electronegativity, which can affect the compound's overall polarity and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may exhibit interesting pharmacological properties due to its structural features, which could be relevant in medicinal chemistry. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₁H₁₅ClF₃NO₃

InChI: InChI=1S/C11H14F3NO3.ClH/c1-16-7-4-6(10(15)11(12,13)14)5-8(17-2)9(7)18-3;/h4-5,10H,15H2,1-3H3;1H

InChI key: InChIKey=KMVUUENKWZPFLA-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(N)C1=CC(OC)=C(OC)C(OC)=C1.Cl

Synonyms:

• Benzenemethanamine, 3,4,5-trimethoxy-α-(trifluoromethyl)-, hydrochloride (1:1)
• 2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethan-1-amine hydrochloride

2,2,2-Trifluoro-1-(3,4,5-trimethoxyphenyl)ethan-1-amine hydrochloride

CAS: 1443981-73-4

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClF₃NO₃

Purity: Min. 95%

Molecular weight: 301.69 g/mol

Ref: 3D-THC98173