CAS 1443981-83-6: 4,4-Difluoro-1,3(2H,4H)-isoquinolinedione
Description:4,4-Difluoro-1,3(2H,4H)-isoquinolinedione is a synthetic organic compound characterized by its unique bicyclic structure, which includes a fused isoquinoline and diketone moiety. This compound features two fluorine atoms positioned at the 4,4-positions of the isoquinoline ring, which can significantly influence its chemical reactivity and physical properties. Typically, such fluorinated compounds exhibit enhanced lipophilicity and stability, making them of interest in medicinal chemistry and material science. The presence of the diketone functional groups contributes to its potential as a versatile building block in organic synthesis. Additionally, the compound may exhibit interesting biological activities, although specific biological data would depend on empirical studies. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be relevant in drug design and development. Overall, 4,4-Difluoro-1,3(2H,4H)-isoquinolinedione represents a valuable compound for research in both synthetic and applied chemistry contexts.
Formula:C9H5F2NO2
InChI:InChI=1S/C9H5F2NO2/c10-9(11)6-4-2-1-3-5(6)7(13)12-8(9)14/h1-4H,(H,12,13,14)
InChI key:InChIKey=CNHMPGXYLZDVCT-UHFFFAOYSA-N
SMILES:O=C1NC(=O)C(F)(F)C=2C=CC=CC12
- Synonyms:
- 4,4-Difluoro-1,3(2H,4H)-isoquinolinedione
- 1,3(2H,4H)-Isoquinolinedione, 4,4-difluoro-

4,4-Difluoro-1,2,3,4-Tetrahydroisoquinoline-1,3-Dione
Ref: IN-DA00HX2P
100mg | To inquire | ||
250mg | To inquire |

4,4-DIFLUORO-1,2,3,4-TETRAHYDROISOQUINOLINE-1,3-DIONE
Ref: 10-F505766
100mg | To inquire | ||
250mg | To inquire |

4,4-Difluoro-1,2,3,4-tetrahydroisoquinoline-1,3-dione
Controlled ProductRef: TR-B426860
10mg | 139.00 € | ||
50mg | 475.00 € | ||
100mg | 829.00 € |

4,4-Difluoro-1,2,3,4-tetrahydroisoquinoline-1,3-dione
Ref: 3D-THC98183
1g | 865.00 € | ||
100mg | 406.00 € |