CAS 1443981-89-2

Ethyl N-[[[(4-bromophenyl)methyl]amino]thioxomethyl]carbamate

Description:

Ethyl N-[[[(4-bromophenyl)methyl]amino]thioxomethyl]carbamate, identified by its CAS number 1443981-89-2, is a chemical compound that features a complex structure characterized by the presence of a carbamate functional group, a thioxomethyl moiety, and a bromophenyl substituent. This compound is likely to exhibit properties typical of carbamates, such as potential biological activity, which may include herbicidal or pesticidal effects, given the presence of the bromophenyl group that can enhance lipophilicity and biological interactions. The thioxomethyl group may contribute to its reactivity and stability under certain conditions. Ethyl N-[[[(4-bromophenyl)methyl]amino]thioxomethyl]carbamate may also display moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₃BrN₂O₂S

InChI: InChI=1S/C11H13BrN2O2S/c1-2-16-11(15)14-10(17)13-7-8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3,(H2,13,14,15,17)

InChI key: InChIKey=CUQGYWYUYZSEAY-UHFFFAOYSA-N

SMILES: C(NC(NC(OCC)=O)=S)C1=CC=C(Br)C=C1

Synonyms:

• Carbamic acid, N-[[[(4-bromophenyl)methyl]amino]thioxomethyl]-, ethyl ester
• Ethyl N-[[[(4-bromophenyl)methyl]amino]thioxomethyl]carbamate