CAS 1443982-05-5

1H-Imidazo[4,5-c]pyridine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:

1H-Imidazo[4,5-c]pyridine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its imidazo[4,5-c]pyridine core structure, which is a bicyclic heterocyclic compound. This substance features a tetrahydro configuration, indicating the presence of a saturated ring system, and a 4-fluorophenyl substituent, which introduces a fluorine atom on a phenyl ring, potentially influencing its biological activity and lipophilicity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular interactions, such as hydrogen bonding and π-π stacking, can be significant in biological systems. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the functional groups present. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₂H₁₂FN₃·ClH

InChI: InChI=1S/C12H12FN3.ClH/c13-9-1-3-10(4-2-9)16-8-15-11-7-14-6-5-12(11)16;/h1-4,8,14H,5-7H2;1H

InChI key: InChIKey=AGRXFZKNPGAPTQ-UHFFFAOYSA-N

SMILES: FC1=CC=C(N2C3=C(N=C2)CNCC3)C=C1.Cl

Synonyms:

• 1H-Imidazo[4,5-c]pyridine, 1-(4-fluorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)

1-(4-Fluorophenyl)-1H,4H,5H,6H,7H-imidazo[4,5-c]pyridine hydrochloride

CAS: 1443982-05-5

Versatile small molecule scaffold

Formula: C₁₂H₁₃ClFN₃

Purity: Min. 95%

Molecular weight: 253.7 g/mol

Ref: 3D-THC98205