CAS 1443982-09-9

Benzenemethanamine, 2-(difluoromethoxy)-α-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-(difluoromethoxy)-α-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1443982-09-9, is a chemical compound characterized by its complex structure, which includes a benzene ring, an amine group, and multiple fluorinated substituents. The presence of the difluoromethoxy and trifluoromethyl groups contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit interesting reactivity due to the electron-withdrawing nature of the fluorine atoms, influencing its behavior in various chemical reactions. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₉H₈F₅NO·ClH

InChI: InChI=1S/C9H8F5NO.ClH/c10-8(11)16-6-4-2-1-3-5(6)7(15)9(12,13)14;/h1-4,7-8H,15H2;1H

InChI key: InChIKey=GQTOFYRWLWSCGR-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(N)C1=C(OC(F)F)C=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 2-(difluoromethoxy)-α-(trifluoromethyl)-, hydrochloride (1:1)

1-[2-(Difluoromethoxy)phenyl]-2,2,2-trifluoroethan-1-amine hydrochloride

CAS: 1443982-09-9

Versatile small molecule scaffold

Formula: C₉H₉ClF₅NO

Purity: Min. 95%

Molecular weight: 277.62 g/mol

Ref: 3D-THC98209