CAS 1443983-85-4: 1,1-Dimethylethyl 3-(fluoromethyl)-1-azetidinecarboxylate
Description:1,1-Dimethylethyl 3-(fluoromethyl)-1-azetidinecarboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the dimethyl group at the 1-position contributes to its steric bulk, while the fluoromethyl group at the 3-position introduces a polar functional group that can influence its reactivity and solubility. The carboxylate functional group enhances its potential for interactions in various chemical environments, making it a candidate for applications in medicinal chemistry and organic synthesis. This compound may exhibit unique properties such as specific reactivity patterns, stability under certain conditions, and potential biological activity, which can be explored further in research and development contexts. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the presence of other reactive species. Overall, the compound's characteristics make it a subject of interest in the field of organic chemistry.
Formula:C9H16FNO2
InChI:InChI=1S/C9H16FNO2/c1-9(2,3)13-8(12)11-5-7(4-10)6-11/h7H,4-6H2,1-3H3
InChI key:InChIKey=HIRURDIZPUXBPT-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CC(CF)C1
- Synonyms:
- 1,1-Dimethylethyl 3-(fluoromethyl)-1-azetidinecarboxylate
- 1-Azetidinecarboxylic acid, 3-(fluoromethyl)-, 1,1-dimethylethyl ester
- tert-Butyl 3-(Fluoromethyl)azetidine-l-carboxylate

1-Azetidinecarboxylic acid, 3-(fluoromethyl)-, 1,1-dimethylethyl ester
Ref: IN-DA001JG7
1g | 336.00 € | ||
5g | To inquire | ||
100mg | 114.00 € | ||
250mg | 199.00 € |

tert-Butyl 3-(fluoromethyl)azetidine-1-carboxylate
Ref: 54-PC100400
1g | 324.00 € | ||
5g | 783.00 € | ||
100mg | 98.00 € | ||
250mg | 176.00 € |

TERT-BUTYL 3-(FLUOROMETHYL)AZETIDINE-1-CARBOXYLATE
Ref: 10-F530920
1g | 249.00 € | ||
5g | 837.00 € | ||
100mg | 86.00 € | ||
250mg | 131.00 € |

tert-butyl 3-(fluoromethyl)azetidine-1-carboxylate
Ref: 3D-THC98385
1g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |