CAS 14440-47-2

2-(4-Chloro-2-formylphenoxy)acetic acid

Description:

2-(4-Chloro-2-formylphenoxy)acetic acid, with the CAS number 14440-47-2, is an organic compound characterized by its aromatic structure and functional groups. It features a chloro-substituted phenyl ring, which contributes to its reactivity and potential biological activity. The presence of the formyl group (-CHO) indicates that it can participate in various chemical reactions, such as condensation and oxidation. The acetic acid moiety provides acidic properties, allowing it to engage in acid-base reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility in polar solvents suggests that it can interact with biological systems, making it of interest in medicinal chemistry. Additionally, the chlorine atom can enhance the compound's lipophilicity and influence its pharmacokinetic properties. Overall, 2-(4-Chloro-2-formylphenoxy)acetic acid is a versatile compound with potential applications in various chemical and biological fields.

Formula: C₉H₇ClO₄

InChI: InChI=1S/C9H7ClO4/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13/h1-4H,5H2,(H,12,13)

InChI key: InChIKey=VXVIICNFYDEOJG-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=C(C=O)C=C(Cl)C=C1

Synonyms:

• 2-(4-Chloro-2-formylphenoxy)acetic acid
• 7,846 Rp
• Acetic acid, (4-chloro-2-formylphenoxy)-
• Acetic acid, 2-(4-chloro-2-formylphenoxy)-
• Fcpa
• Rp 7846
• (4-Chloro-2-formylphenoxy)acetic acid

Acetic acid, 2-(4-chloro-2-formylphenoxy)-

CAS: 14440-47-2

Formula: C₉H₇ClO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.6025

Ref: IN-DA001JGO

2-(4-Chloro-2-formylphenoxy)acetic acid

CAS: 14440-47-2

2-(4-Chloro-2-formylphenoxy)acetic acid

Purity: 95%

Molecular weight: 214.6g/mol

Ref: 54-OR1036365

(4-chloro-2-formylphenoxy)acetic acid

CAS: 14440-47-2

Formula: C₉H₇ClO₄

Purity: 95%

Molecular weight: 214.6

Ref: 10-F309927

2-(4-Chloro-2-formylphenoxy)acetic acid

CAS: 14440-47-2

2-(4-Chloro-2-formylphenoxy)acetic acid is a chemical compound that is found in microalgae. The compound has been shown to inhibit the growth of bacteria by binding to glucose transporters and inhibiting their ability to absorb glucose. This process leads to a decrease in ATP levels, energy depletion, and cell death. In addition, this compound has been shown to have trophic effects on microalgae. This compound also inhibits the expression of malic enzyme genes and ammonium transporter genes in bacteria. 2-(4-Chloro-2-formylphenoxy)acetic acid is a steerable molecule that can be used for sectioning biological material with ultrafast lasers due to its high fluorescence.

Formula: C₉H₇ClO₄

Purity: Min. 95%

Molecular weight: 214.6 g/mol

Ref: 3D-PAA44047