CAS 14440-56-3
:2,3:5,6-Di-O-isopropylidene-D-mannono-1,4-lactone
Description:
2,3:5,6-Di-O-isopropylidene-D-mannono-1,4-lactone is a chemical compound that belongs to the class of lactones, specifically a derivative of D-mannose. It features two isopropylidene protecting groups, which enhance its stability and solubility in organic solvents. This compound is typically a white to off-white crystalline solid, and it is soluble in common organic solvents such as dichloromethane and methanol, but less soluble in water due to its hydrophobic isopropylidene groups. The presence of the lactone structure indicates that it has a cyclic ester formation, which contributes to its reactivity and potential applications in organic synthesis. It is often used as an intermediate in carbohydrate chemistry, particularly in the synthesis of more complex sugar derivatives. The compound's stability and reactivity make it valuable in various chemical reactions, including acylation and glycosylation processes. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C12H18O6
InChI:InChI=1S/C12H18O6/c1-11(2)14-5-6(16-11)7-8-9(10(13)15-7)18-12(3,4)17-8/h6-9H,5H2,1-4H3/t6-,7-,8+,9+/m1/s1
InChI key:InChIKey=OFZPAXSEAVOAKB-HXFLIBJXSA-N
SMILES:O=C1[C@@]2([C@]([C@](O1)([C@]3(COC(C)(C)O3)[H])[H])(OC(C)(C)O2)[H])[H]
Synonyms:- Mannonic acid, 2,3:5,6-di-O-isopropylidene-, γ-lactone, D-
- Furo[3,4-d]-1,3-dioxole, D-mannonic acid deriv.
- D-Mannonic acid, 2,3:5,6-bis-O-(1-methylethylidene)-, γ-lactone
- 2,3:5,6-Di-O-isopropylidene-D-mannono-1,4-lactone
- Mannonic acid, 2,3:5,6-di-O-isopropylidene-, γ-lactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3:5,6-Di-O-isopropylidene-D-mannonic Acid 1,4-Lactone
CAS:Formula:C12H18O6Molecular weight:258.26772,3:5,6-Di-O-isopropylidene-D-mannonic acid-1,4-lactone
CAS:2,3:5,6-Di-O-isopropylidene-D-mannonic acid-1,4-lactone is an analogue of the furanoid compound mannonic acid. It is a lactone that can be hydrolyzed to carboxylic acids with acidic conditions. This compound has been shown to be a good target molecule for efficient syntheses of alcohols and thiols. The configurations at the stereocenters are analogous to those found in other furanoids. The high yields and yields of this molecule make it an efficient target molecule for synthesis.Formula:C12H18O6Purity:Min. 95%Color and Shape:PowderMolecular weight:258.27 g/mol2,3:5,6-Di-O-isopropylidene-D-mannonic Acid 1,4-Lactone
CAS:Controlled ProductFormula:C12H18O6Color and Shape:NeatMolecular weight:258.268



