CAS 14440-94-9
:3-N-PROPOXYPICOLINIC ACID
Description:
3-N-Propoxypicolinic acid, with the CAS number 14440-94-9, is a chemical compound that belongs to the class of picolinic acids, which are derivatives of pyridine. This substance typically features a propoxy group attached to the nitrogen atom of the pyridine ring, influencing its solubility and reactivity. It is characterized by its ability to form hydrogen bonds due to the presence of both carboxylic acid and nitrogen functionalities, which can enhance its interactions in biological systems. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions, as it may exhibit neuroprotective properties. Additionally, its structural features may allow it to act as a ligand in coordination chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research and application.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-2-6-13-7-4-3-5-10-8(7)9(11)12/h3-5H,2,6H2,1H3,(H,11,12)
SMILES:CCCOc1cccnc1C(=O)O
Synonyms:- 3-Propoxypicolinic Acid
- 3-Propoxypyridine-2-Carboxylic Acid
- 3-N-Propoxypicolinic Acid 96+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Propoxypyridine-2-carboxylic Acid
CAS:Formula:C9H11NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:181.192-Pyridinecarboxylic acid, 3-propoxy-
CAS:Formula:C9H11NO3Purity:97%Color and Shape:SolidMolecular weight:181.18853-Propoxypyridine-2-carboxylic acid
CAS:<p>3-Propoxypyridine-2-carboxylic acid is a benzene ring containing piperidine with a carboxamide substituent. It has shown to be selective for human eosinophils, and is an antagonist at the benzodiazepine site of GABAA receptors. 3-Propoxypyridine-2-carboxylic acid can also be derivatized to form a potent antagonist of benzodiazepine sites on GABAA receptors.</p>Formula:C9H11NO3Purity:Min. 95%Molecular weight:181.19 g/mol





