CAS 144402-92-6
:6-hydrazinophenanthridine
Description:
6-Hydrazinophenanthridine is an organic compound characterized by its phenanthridine backbone, which is a polycyclic aromatic structure. The presence of a hydrazine functional group (-NH-NH2) at the 6-position of the phenanthridine ring imparts unique chemical properties, including potential reactivity in various chemical reactions, such as oxidation and coupling reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure contributes to its solubility and interaction with biological macromolecules. Additionally, 6-hydrazinophenanthridine may be used in the synthesis of other chemical entities or as a reagent in analytical chemistry. Safety data should be consulted, as compounds containing hydrazine derivatives can be hazardous and may require careful handling due to their potential toxicity and reactivity. Overall, 6-hydrazinophenanthridine is a compound of interest in both synthetic and biological chemistry contexts.
Formula:C13H11N3
InChI:InChI=1/C13H11N3/c14-16-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13/h1-8H,14H2,(H,15,16)
SMILES:c1ccc2c(c1)c1ccccc1nc2NN
Synonyms:- 6-Hydrazinylphenanthridine
- Phenanthridine, 6-Hydrazinyl-
- 6-Hydrazinophenanthridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
