CAS 14443-42-6
:N-[3-(4-Morpholinyl)propyl]-4-nitrobenzamide
Description:
N-[3-(4-Morpholinyl)propyl]-4-nitrobenzamide, with the CAS number 14443-42-6, is a chemical compound characterized by its specific functional groups and structural features. It contains a nitro group (-NO2) attached to a benzamide moiety, which contributes to its potential biological activity. The presence of a morpholine ring, a six-membered heterocyclic structure containing oxygen and nitrogen, enhances its solubility and may influence its interaction with biological targets. The propyl chain linking the morpholine to the benzamide provides additional flexibility and steric properties. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific characteristics such as solubility, melting point, and reactivity would require empirical data for precise evaluation. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, underscoring the importance of thorough risk assessment in its application.
Formula:C14H19N3O4
InChI:InChI=1S/C14H19N3O4/c18-14(12-2-4-13(5-3-12)17(19)20)15-6-1-7-16-8-10-21-11-9-16/h2-5H,1,6-11H2,(H,15,18)
InChI key:InChIKey=ZEWOVHOFRWMQPJ-UHFFFAOYSA-N
SMILES:C(NCCCN1CCOCC1)(=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Benzamide, N-[3-(4-morpholinyl)propyl]-4-nitro-
- Benzamide, N-(3-morpholinopropyl)-p-nitro-
- N-[3-(4-Morpholinyl)propyl]-4-nitrobenzamide
- 5500HnE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.