CAS 144432-85-9
:3-Chloro-4-fluorophenylboronic acid
Description:
3-Chloro-4-fluorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both chlorine and fluorine atoms. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. Its molecular structure features a phenyl ring with a chlorine atom at the meta position and a fluorine atom at the para position relative to the boronic acid group. The presence of these halogen substituents can influence the compound's reactivity and its ability to participate in various chemical reactions, such as Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique properties make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C6H5BClFO2
Synonyms:- 3-Chloro-4-fluorobenzeneboronic acid
- 4-Fluoro-3-Chlorophenylboronic Acid
- (3-Chloro-4-Fluorophenyl)-Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Chloro-4-fluorobenzeneboronic acid, 98%
CAS:<p>3-Chloro-4-fluorobenzeneboronic acid is used as a reactant for Rh-catalyzed asymmetric addition reactions, palladium-catalyzed oxidative cross-coupling reaction and Suzuki-Miyaura coupling. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some d</p>Formula:C6H5BClFO2Purity:98%Color and Shape:Powder, White to pale creamMolecular weight:174.36Boronic acid, B-(3-chloro-4-fluorophenyl)-
CAS:Formula:C6H5BClFO2Purity:98%Color and Shape:SolidMolecular weight:174.36513-Chloro-4-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BClFO2Purity:97.0 to 112.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:174.363-Chloro-4-fluorobenzeneboronic acid
CAS:3-Chloro-4-fluorobenzeneboronic acidFormula:C6H5BClFO2Purity:≥95%Color and Shape: white solidMolecular weight:174.37g/mol3-Chloro-4-fluorobenzeneboronic acid
CAS:Formula:C6H5BClFO2Purity:98%Color and Shape:SolidMolecular weight:174.363-Chloro-4-fluorophenylboronic Acid-d3
CAS:Controlled ProductFormula:C6D3H2BClFO2Color and Shape:NeatMolecular weight:177.384






