CAS 144450-13-5
:tyr-(trp2)-msh release inhibiting*factor trifluor
Description:
Tyr-(Trp2)-MSH Release Inhibiting Factor Trifluor, identified by the CAS number 144450-13-5, is a synthetic peptide that plays a role in the regulation of melanocyte-stimulating hormone (MSH) release. This compound is characterized by its specific amino acid sequence, which includes tyrosine (Tyr) and tryptophan (Trp), contributing to its biological activity. The trifluor designation suggests the presence of trifluoromethyl groups, which can enhance the compound's stability and lipophilicity, potentially influencing its pharmacokinetic properties. Peptides like this one are often studied for their effects on pigmentation, appetite regulation, and other physiological processes. The compound's structure allows it to interact with specific receptors in the body, making it of interest in research related to endocrinology and dermatology. As with many peptides, its stability, solubility, and biological activity can be influenced by factors such as pH and temperature, which are critical for its application in therapeutic contexts.
Formula:C27H32N6O5
InChI:InChI=1/C27H32N6O5/c28-20(12-16-7-9-18(34)10-8-16)27(38)33-11-3-6-23(33)26(37)32-22(25(36)31-15-24(29)35)13-17-14-30-21-5-2-1-4-19(17)21/h1-2,4-5,7-10,14,20,22-23,30,34H,3,6,11-13,15,28H2,(H2,29,35)(H,31,36)(H,32,37)
SMILES:c1ccc2c(c1)c(CC(C(=NCC(=N)O)O)N=C(C1CCCN1C(=O)C(Cc1ccc(cc1)O)N)O)c[nH]2
Synonyms:- (Tyr0,Trp2)-Melanocyte-Stimulating Hormone-Release Inhibiting Factor
- H-Tyr-Pro-Trp-Gly-NH2
- L-tyrosyl-L-prolyl-L-tryptophylglycinamide
- Tyrosylprolyltryptophylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tyr-W-MIF-1
CAS:Tyr-W-MIF-1, an opioid tetrapeptide, exhibits both opiate and antiopiate activities, and has been demonstrated to induce analgesia [1] [2] [5].Formula:C27H32N6O5Molecular weight:520.58
