CAS 144465-94-1
:1-(2-Pyridinyl)-4-piperidinamine
Description:
1-(2-Pyridinyl)-4-piperidinamine, also known by its CAS number 144465-94-1, is a chemical compound characterized by its unique structure that includes a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms in both the piperidine and pyridine rings. It is often studied for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for drug development. The presence of the pyridine ring can influence its solubility and reactivity, making it a candidate for various chemical reactions. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored in pharmacological studies. Its synthesis and characterization are important for understanding its potential applications in therapeutic contexts. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be leveraged in material science or catalysis.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c11-9-4-7-13(8-5-9)10-3-1-2-6-12-10/h1-3,6,9H,4-5,7-8,11H2
SMILES:c1ccnc(c1)N1CCC(CC1)N
Synonyms:- 1-(Pyridin-2-yl)piperidin-4-amine
- 1-Pyridin-2-ylpiperidin-4-amine
- 4-Piperidinamine, 1-(2-Pyridinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(2-Pyridinyl)-4-piperidinamine
CAS:Formula:C10H15N3Purity:98%Color and Shape:SolidMolecular weight:177.24621-(2-Pyridinyl)-4-piperidinamine
CAS:1-(2-Pyridinyl)-4-piperidinamineFormula:C10H15N3Purity:98%Color and Shape: yellow liquidMolecular weight:177.25g/mol(1-Pyridin-2-yl)piperidin-4-amine
CAS:Formula:C10H15N3Purity:95%Color and Shape:SolidMolecular weight:177.251(1-Pyridin-2-yl)piperidin-4-amine
CAS:(1-Pyridin-2-yl)piperidin-4-amine is a drug that acts as an anorexiant. It binds to the serotonin 5HT3 receptor, which is involved in the regulation of appetite and mood. It also blocks the action of serotonin at the 5HT4 receptor, which is involved in mediating intestinal motility. This agent has been shown to have a potent antagonist effect on the 1-4c alkyl group of serotonin receptors. The phenoxy group and methyl group are also responsible for binding with serotonin receptors and blocking their activity.Formula:C10H15N3Purity:Min. 95%Molecular weight:177.25 g/mol



