CAS 144465-95-2

1-(6-Methyl-2-pyridinyl)-4-piperidinamine

Description:

1-(6-Methyl-2-pyridinyl)-4-piperidinamine, identified by its CAS number 144465-95-2, is a chemical compound that features a piperidine ring substituted with a pyridine moiety. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals. The presence of the methyl group on the pyridine ring can influence its lipophilicity and, consequently, its pharmacokinetic properties. The piperidinamine structure suggests that it may interact with various biological targets, including receptors and enzymes, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular structure. As with many nitrogen-containing heterocycles, it may exhibit basic properties, allowing it to form salts with acids, which can enhance its bioavailability. Overall, this compound represents a class of molecules that are valuable in the exploration of therapeutic agents.

Formula: C₁₁H₁₇N₃

InChI: InChI=1S/C11H17N3/c1-9-3-2-4-11(13-9)14-7-5-10(12)6-8-14/h2-4,10H,5-8,12H2,1H3

InChI key: InChIKey=NDXJCHPRFGILTF-UHFFFAOYSA-N

SMILES: CC1=NC(=CC=C1)N2CCC(N)CC2

Synonyms:

• 1-(6-Methyl-2-pyridinyl)-4-piperidinamine
• 4-Piperidinamine, 1-(6-methyl-2-pyridinyl)-

1-(6-Methylpyridin-2-yl)piperidin-4-amine

CAS: 144465-95-2

Versatile small molecule scaffold

Formula: C₁₁H₁₇N₃

Purity: Min. 95%

Molecular weight: 191.27 g/mol

Ref: 3D-UFA46595