CAS 1445-15-4
:2-dimethylamino-6-hydroxypurine
Description:
2-Dimethylamino-6-hydroxypurine, with the CAS number 1445-15-4, is a purine derivative characterized by the presence of a dimethylamino group at the 2-position and a hydroxyl group at the 6-position of the purine ring. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which is indicative of its polar functional groups. It exhibits basic properties due to the dimethylamino group, allowing it to participate in protonation reactions. The hydroxyl group can engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-Dimethylamino-6-hydroxypurine is of interest in biochemical research, particularly in the study of nucleic acids and as a potential precursor in the synthesis of various biologically active compounds. Its structural features contribute to its role in biological systems, including potential effects on nucleoside metabolism and enzyme interactions. As with many purine derivatives, it may also exhibit pharmacological properties, warranting further investigation into its biological activities.
Formula:C7H9N5O
InChI:InChI=1/C7H9N5O/c1-12(2)7-10-5-4(6(13)11-7)8-3-9-5/h3-4H,1-2H3,(H,8,9,10,11,13)
SMILES:CN(C)C1=NC2=NC=NC2C(=N1)O
Synonyms:- N(2)-Dimethylguanine
- 2-Dimethylguanine
- 6H-Purin-6-one, 2-(dimethylamino)-1,7-dihydro-
- 2-(dimethylamino)-3,7-dihydro-6H-purin-6-one
- 2-(dimethylamino)-3,5-dihydro-6H-purin-6-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6H-Purin-6-one, 2-(dimethylamino)-1,9-dihydro-
CAS:Formula:C7H9N5OPurity:95%Color and Shape:SolidMolecular weight:179.17932-Dimethylamino-6-hydroxypurine
CAS:Formula:C7H9N5OPurity:≥ 98.0%Color and Shape:Off-white to yellow powderMolecular weight:179.182-(Dimethylamino)-7H-purin-6-ol
CAS:2-(Dimethylamino)-7H-purin-6-olPurity:95%Molecular weight:179.18g/mol2-Dimethylamino-6-hydroxypurine
CAS:Controlled ProductFormula:C7H9N5OColor and Shape:NeatMolecular weight:179.182-Dimethylamino-6-hydroxypurine
CAS:<p>2-Dimethylamino-6-hydroxypurine is a biochemical that belongs to the group of purines. It is a methylated form of 2,6-diaminopurine and has been shown to be an antigenic product in wheat germ. 2,6-Diaminopurine is involved in the synthesis of protein and other biomolecules by transferring methyl groups from S-adenosyl methionine to amino acid side chains. This gene product is also involved in enzyme preparations and reactions that are related to the biochemical properties of mammalian cells. The methyltransferase enzyme catalyzes the reaction mechanism for 2,6-dimethylamino-purine. 2,6-Dimethylamino-purine has been shown to have anticancer effects on various types of cancer cells with modifications on their DNA.</p>Formula:C7H9N5OPurity:Min. 95%Color and Shape:Off-white to yellow solid.Molecular weight:179.18 g/mol




