CAS 1445-56-3

3-Chloropyridazine-4-carbonitrile

Description:

3-Chloropyridazine-4-carbonitrile is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The compound features a chlorine substituent at the 3-position and a cyano group (-C≡N) at the 4-position of the pyridazine ring. This structure contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the cyano group enhances its utility in synthetic chemistry, as it can participate in nucleophilic reactions. Additionally, the chlorine atom can influence the compound's electronic properties and solubility. 3-Chloropyridazine-4-carbonitrile is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest for its potential applications in the development of biologically active molecules.

Formula: C₅H₂ClN₃

InChI: InChI=1S/C5H2ClN3/c6-5-4(3-7)1-2-8-9-5/h1-2H

InChI key: InChIKey=GAQMHKPMJLFJPC-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Cl)N=NC=C1

Synonyms:

• 3-Chloro-4-pyridazinecarbonitrile
• 4-Cyano-3-chloropyridazine
• 4-Pyridazinecarbonitrile, 3-Chloro-
• 3-Chloropyridazine-4-carbonitrile

4-Pyridazinecarbonitrile, 3-chloro-

CAS: 1445-56-3

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.5425

Ref: IN-DA001JND

3-Chloropyridazine-4-carbonitrile

CAS: 1445-56-3

3-Chloropyridazine-4-carbonitrile

Purity: 95%

Molecular weight: 139.54g/mol

Ref: 54-OR965408

3-Chloropyridazine-4-carbonitrile

CAS: 1445-56-3

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.54

Ref: 10-F079726

3-Chloropyridazine-4-carbonitrile

CAS: 1445-56-3

3-Chloropyridazine-4-carbonitrile is an acridone that has been shown to be an effective antibacterial agent. It was synthesized by the intramolecular Diels-Alder reaction of pyridine and 1,3-butadiene, followed by a sequence of reactions involving thioxanthones. 3-Chloropyridazine-4-carbonitrile binds to the bacterial enzyme 50S ribosomal subunit by competitive inhibition and prevents the formation of an antibiotic inhibitor complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. 3-Chloropyridazine-4-carbonitrile also has shown activity against methicillin resistant Staphylococcus aureus strains.

Formula: C₅H₂ClN₃

Purity: Min. 95%

Molecular weight: 139.54 g/mol

Ref: 3D-FC156406