CAS 1445-58-5

6-Mercapto-3(2H)-pyridazinethione

Description:

6-Mercapto-3(2H)-pyridazinethione, with the CAS number 1445-58-5, is a heterocyclic compound featuring a pyridazine ring substituted with a thiol group. This compound is characterized by its sulfur-containing functional group, which imparts unique chemical reactivity, particularly in nucleophilic substitution reactions. It typically exhibits moderate solubility in polar solvents due to the presence of the thiol group, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with various biological targets, and it may serve as a precursor for the synthesis of more complex molecules. Additionally, the presence of the mercapto group suggests that it could participate in redox reactions, contributing to its utility in various chemical applications. Overall, 6-Mercapto-3(2H)-pyridazinethione is a versatile compound with potential applications in both synthetic and biological chemistry.

Formula: C₄H₄N₂S₂

InChI: InChI=1S/C4H4N2S2/c7-3-1-2-4(8)6-5-3/h1-2H,(H,5,7)(H,6,8)

InChI key: InChIKey=ICIMHRGIRRYUIW-UHFFFAOYSA-N

SMILES: S=C1C=CC(=S)NN1

Synonyms:

• 3,6-Pyridazinedithiol
• 3(2H)-Pyridazinethione, 6-mercapto-
• 3,6-Dimercaptopyridazine
• 3,6-Pyridazinedithione, 1,2-dihydro-
• 6-Mercapto-3(2H)-pyridazinethione

3(2H)-Pyridazinethione, 6-mercapto-

CAS: 1445-58-5

Formula: C₄H₄N₂S₂

Molecular weight: 144.218

Ref: IN-DA001JNC

Pyridazine-3,6-dithiol

CAS: 1445-58-5

Formula: C₄H₄N₂S₂

Purity: 98.0%

Color and Shape: Liquid, No data available.

Molecular weight: 144.21

Ref: 10-F180154