CAS 1445-69-8
:2,3-Dihydro-1,4-phthalazinedione
Description:
2,3-Dihydro-1,4-phthalazinedione, with the CAS number 1445-69-8, is a heterocyclic organic compound characterized by its bicyclic structure that includes a phthalazine core. This compound features two carbonyl groups (ketones) at the 1 and 4 positions, contributing to its reactivity and potential applications in various chemical reactions. It is typically a white to light yellow solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the carbonyl groups makes it susceptible to nucleophilic attack, allowing it to participate in various organic synthesis reactions. Additionally, 2,3-dihydro-1,4-phthalazinedione can act as a ligand in coordination chemistry due to its ability to form chelates with metal ions. Its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Overall, this compound serves as a valuable building block in organic synthesis and materials science, with potential applications in pharmaceuticals and agrochemicals.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H,(H,9,11)(H,10,12)
InChI key:InChIKey=KGLPWQKSKUVKMJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)NN1)=CC=CC2
Synonyms:- 1,2,3,4-Tetrahydrophthalazine-1,4-dione
- 1,2-Benzenedicarboxylic acid, cyclic hydrazide
- 1,4-Dihydroxyphthalazine
- 1,4-Ketophthalazine
- 1,4-Phthalazinediol
- 1,4-Phthalazinedione, 2,3-dihydro-
- 1-Bromo-2-Fluoroethane
- 2,3-Dihydro-1,4-phthalazinedione
- 2,3-Dihydro-4-Phthalazinedione
- 2,3-Dihydrophthalazine-1,4-Dione
- 4-Hydroxyphthalazin-1(2H)-one
- 4A,8A-Dihydrophthalazine-1,4-Dione
- Hydrazine, 1,2-(1,2-phenylenedicarbonyl)-
- N,N-phthaloylhydrazine
- NSC 201511
- NSC 651
- Phtalylhydrazine
- Phthalazine-1,4(2H,3H)-dione
- Phthalhydrazide, (2,3-Dihydro-1,4-phthalazinedione)
- Phthalhydrazine
- Phthalic Hydrazide
- Phthalic acid cyclic hydrazide
- Phthalocyclohydrazide
- Phthaloylhydrazine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Phthalic Hydrazide
CAS:Formula:C8H6N2O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:162.15Phthalhydrazide, 98%
CAS:Phthalhydrazide is a reagent used in the synthesis of various pyrazolophthalazine derivatives is and used in medicine double hydrazine phthalocyanine work intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labFormula:C8H6N2O2Purity:98%Color and Shape:Powder and/or chunks, White to pale creamMolecular weight:162.151,4-Phthalazinedione, 2,3-dihydro-
CAS:Formula:C8H6N2O2Purity:98%Color and Shape:SolidMolecular weight:162.1454Primaquine Impurity 3 (Phthalhydrazide)
CAS:Formula:C8H6N2O2Color and Shape:White To Off-White SolidMolecular weight:162.15Phthalic Hydrazide
CAS:Applications Phthalic Hydrazide is a reagent in the synthesis in various pyrazolophthalazine derivatives.
References Rezaei, S.et al.: Tetra. Lett., 53, 5123 (2012);Formula:C8H6N2O2Color and Shape:NeatMolecular weight:162.152,3-Dihydrophthalazine-1,4-dione
CAS:Formula:C8H6N2O2Purity:98%Color and Shape:White to almost white powderMolecular weight:162.148Phthalyl Hydrazide pure, 98%
CAS:Formula:C8H6N2O2Purity:min. 98%Color and Shape:Off - white, PowderMolecular weight:162.15








