CAS 1445-69-8: 2,3-Dihydro-1,4-phthalazinedione
Description:2,3-Dihydro-1,4-phthalazinedione, with the CAS number 1445-69-8, is a heterocyclic organic compound characterized by its bicyclic structure that includes a phthalazine core. This compound features two carbonyl groups (ketones) at the 1 and 4 positions, contributing to its reactivity and potential applications in various chemical reactions. It is typically a white to light yellow solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the carbonyl groups makes it susceptible to nucleophilic attack, allowing it to participate in various organic synthesis reactions. Additionally, 2,3-dihydro-1,4-phthalazinedione can act as a ligand in coordination chemistry due to its ability to form chelates with metal ions. Its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Overall, this compound serves as a valuable building block in organic synthesis and materials science, with potential applications in pharmaceuticals and agrochemicals.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H,(H,9,11)(H,10,12)
InChI key:InChIKey=KGLPWQKSKUVKMJ-UHFFFAOYSA-N
SMILES:O=C1NNC(=O)C=2C=CC=CC12
- Synonyms:
- 1,2,3,4-Tetrahydrophthalazine-1,4-dione
- 1,2-Benzenedicarboxylic acid, cyclic hydrazide
- 1,4-Dihydroxyphthalazine
- 1,4-Ketophthalazine
- 1,4-Phthalazinediol
- 1,4-Phthalazinedione, 2,3-dihydro-
- 1-Bromo-2-Fluoroethane
- 2,3-Dihydro-1,4-phthalazinedione
- 2,3-Dihydro-4-Phthalazinedione
- 2,3-Dihydrophthalazine-1,4-Dione
- See more synonyms
- 4-Hydroxyphthalazin-1(2H)-one
- 4A,8A-Dihydrophthalazine-1,4-Dione
- Hydrazine, 1,2-(1,2-phenylenedicarbonyl)-
- N,N-phthaloylhydrazine
- NSC 201511
- NSC 651
- Phtalylhydrazine
- Phthalazine-1,4(2H,3H)-dione
- Phthalhydrazide, (2,3-Dihydro-1,4-phthalazinedione)
- Phthalhydrazine
- Phthalic Hydrazide
- Phthalic acid cyclic hydrazide
- Phthalocyclohydrazide
- Phthaloylhydrazine
- Phthalhydrazide
