CymitQuimica logo

CAS 14453-65-7

:

1-(2-AMINOPHENYL)PYRROLIDIN-2-ONE

Description:
1-(2-Aminophenyl) pyrrolidin-2-one, with the CAS number 14453-65-7, is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring and an amino group attached to a phenyl ring. This compound typically exhibits properties associated with both amines and cyclic ketones, making it a versatile molecule in organic synthesis and medicinal chemistry. It is often studied for its potential biological activities, including its role as a building block in the synthesis of pharmaceuticals. The presence of the amino group can influence its reactivity and solubility, while the pyrrolidinone structure may contribute to its stability and interaction with biological targets. Additionally, this compound may exhibit various physical properties such as melting point, boiling point, and solubility in different solvents, which are essential for its application in research and industry. Overall, 1-(2-Aminophenyl) pyrrolidin-2-one is of interest for its potential applications in drug development and as a chemical intermediate.
Formula:C10H12N2O
InChI:InChI=1/C10H12N2O/c11-8-4-1-2-5-9(8)12-7-3-6-10(12)13/h1-2,4-5H,3,6-7,11H2
InChI key:OFWIPSFSNBNOQC-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)N)N1CCCC1=O
Synonyms:
  • 2-Pyrrolidinone, 1-(2-Aminophenyl)-
Found 3 products.