CAS 1445603-41-7

1,1-Dimethylethyl 6-chloro-1,2-dihydro-2-oxospiro[3H-indole-3,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 6-chloro-1,2-dihydro-2-oxospiro[3H-indole-3,4′-piperidine]-1′-carboxylate, with the CAS number 1445603-41-7, is a chemical compound characterized by its complex structure, which includes a spirocyclic framework. This compound features a piperidine ring fused to an indole moiety, indicating potential biological activity, particularly in medicinal chemistry. The presence of a chloro substituent and a carboxylate group suggests that it may exhibit unique reactivity and solubility properties. The dimethyl group contributes to steric hindrance, which can influence the compound's interaction with biological targets. Additionally, the oxo group indicates the presence of a carbonyl functionality, which may play a role in the compound's reactivity and stability. Overall, this compound's structural features suggest it could be of interest in drug development, particularly for its potential pharmacological properties. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₇H₂₁ClN₂O₃

InChI: InChI=1S/C17H21ClN2O3/c1-16(2,3)23-15(22)20-8-6-17(7-9-20)12-5-4-11(18)10-13(12)19-14(17)21/h4-5,10H,6-9H2,1-3H3,(H,19,21)

InChI key: InChIKey=CQDZREPVGUJDMU-UHFFFAOYSA-N

SMILES: O=C1C2(C=3C(N1)=CC(Cl)=CC3)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 6-chloro-1,2-dihydro-2-oxospiro[3H-indole-3,4′-piperidine]-1′-carboxylate
• Spiro[3H-indole-3,4′-piperidine]-1′-carboxylic acid, 6-chloro-1,2-dihydro-2-oxo-, 1,1-dimethylethyl ester

Tert-Butyl6-chloro-2-oxo-1,2-dihydrospiro[indole-3,4'-piperidine]-1'-carboxylate

CAS: 1445603-41-7

Purity: 95%

Molecular weight: 336.82000732421875

Ref: 10-F096418