CAS 144584-65-6
:1-Bromo-3-chloro-2-fluorobenzene
Description:
1-Bromo-3-chloro-2-fluorobenzene is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. Specifically, it features a bromine atom at the first position, a chlorine atom at the third position, and a fluorine atom at the second position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively high stability due to the resonance of the aromatic system, but it can undergo nucleophilic substitution reactions due to the presence of the halogen substituents. The presence of multiple halogens can influence its reactivity, solubility, and boiling point. Additionally, 1-bromo-3-chloro-2-fluorobenzene is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as halogenated aromatic compounds can be toxic and environmentally persistent.
Formula:C6H3BrClF
InChI:InChI=1/C6H3BrClF/c7-4-2-1-3-5(8)6(4)9/h1-3H
SMILES:c1cc(c(c(c1)Cl)F)Br
Synonyms:- 3-Chloro-2-fluorobromobenzene
- 2-Chloro-2-fluorobromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Bromo-3-chloro-2-fluorobenzene
CAS:Formula:C6H3BrClFPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:209.441-Bromo-3-chloro-2-fluorobenzene, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H3BrClFPurity:95%Molecular weight:209.44Benzene, 1-bromo-3-chloro-2-fluoro-
CAS:Formula:C6H3BrClFPurity:98%Color and Shape:SolidMolecular weight:209.4434Ref: IN-DA001JST
1g21.00€5g24.00€10g26.00€1kg275.00€25g30.00€50g47.00€5kgTo inquire100g71.00€10kgTo inquire250g111.00€500g194.00€3-Chloro-2-fluorobromobenzene
CAS:3-Chloro-2-fluorobromobenzeneFormula:C6H3BrClFPurity:98%Color and Shape: colourless to white solidMolecular weight:209.44g/mol1-Bromo-3-chloro-2-fluorobenzene
CAS:Formula:C6H3BrClFPurity:98%Color and Shape:SolidMolecular weight:209.44




