CymitQuimica logo

CAS 1445856-13-2

:

Tert-Butyl 5-Bromo-1H-Pyrrolo[2,3-C]Pyridine-1-Carboxylate

Description:
Tert-Butyl 5-Bromo-1H-Pyrrolo[2,3-C]Pyridine-1-Carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a bromine atom at the 5-position and a tert-butyl ester group at the carboxylate position. This compound typically exhibits moderate to high lipophilicity due to the presence of the tert-butyl group, which can influence its solubility in organic solvents. The bromine substituent can enhance reactivity, making it a potential candidate for further chemical transformations or applications in medicinal chemistry. The pyrrolopyridine framework is of interest in various fields, including pharmaceuticals, due to its biological activity and potential as a scaffold for drug development. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, Tert-Butyl 5-Bromo-1H-Pyrrolo[2,3-C]Pyridine-1-Carboxylate represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C12H13BrN2O2
InChI:InChI=1S/C12H13BrN2O2/c1-12(2,3)17-11(16)15-5-4-8-6-10(13)14-7-9(8)15/h4-7H,1-3H3
InChI key:FNHHCNWSEUASDD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C=CC2=CC(=NC=C21)Br
Synonyms:
  • Tert-Butyl 5-Bromo-1H-Pyrrolo[2,3-C]Pyridine-1-Carboxylate
  • 5-Bromo-pyrrolo[2,3-c]pyridine-1-carboxylic acid tert-butyl ester
  • tert-butyl 5-bromopyrrolo[2,3-c]pyridine-1-carboxylate
  • 1H-Pyrrolo[2,3-c]pyridine-1-carboxylic acid, 5-bromo-, 1,1-dimethylethyl ester
Found 3 products.