CAS 1445950-80-0

1,5-Dimethyl-1H-pyrrole-3-carboxylic acid

Description:

1,5-Dimethyl-1H-pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two methyl groups at the 1 and 5 positions of the pyrrole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 3 position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The compound is likely to exhibit polar characteristics due to the carboxylic acid group, influencing its solubility in polar solvents. Additionally, the methyl substituents can affect the steric hindrance and electronic distribution within the molecule, potentially impacting its biological activity and interactions with other molecules. While specific applications may vary, compounds of this nature are often explored in medicinal chemistry and materials science for their potential utility in drug development and synthesis of novel materials.

Formula: C₇H₉NO₂

InChI: InChI=1S/C7H9NO2/c1-5-3-6(7(9)10)4-8(5)2/h3-4H,1-2H3,(H,9,10)

InChI key: InChIKey=YFHWYDVJHRDYAP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C)N(C)C1

Synonyms:

• 1,5-Dimethyl-1H-pyrrole-3-carboxylic acid
• 1H-Pyrrole-3-carboxylic acid, 1,5-dimethyl-

1,5-Dimethyl-1H-Pyrrole-3-Carboxylic Acid

CAS: 1445950-80-0

Versatile small molecule scaffold

Formula: C₇H₉NO₂

Purity: Min. 95%

Molecular weight: 139.15 g/mol

Ref: 3D-VHC95080