CymitQuimica logo

CAS 1445995-78-7

:

7-Bromo-6-fluorobenzoxazole

Description:
7-Bromo-6-fluorobenzoxazole is a heterocyclic organic compound characterized by the presence of a benzoxazole ring, which consists of a fused benzene and oxazole moiety. The compound features a bromine atom at the 7-position and a fluorine atom at the 6-position of the benzoxazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds like 7-Bromo-6-fluorobenzoxazole may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its molecular structure allows for potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C7H3BrFNO
InChI:InChI=1S/C7H3BrFNO/c8-6-4(9)1-2-5-7(6)11-3-10-5/h1-3H
InChI key:InChIKey=FHNAANRDWTYLRN-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1F)N=CO2
Synonyms:
  • 7-Bromo-6-fluorobenzoxazole
  • Benzoxazole, 7-bromo-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.