
CAS 1446-06-6
:4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, compd. with 2-(dimethylamino)ethanol (1:1)
Description:
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, compound with 2-(dimethylamino)ethanol (1:1), known by its CAS number 1446-06-6, is a chemical compound that features a pyrimidine ring substituted with carboxylic acid and a tetrahydro structure. This compound exhibits characteristics typical of both pyrimidine derivatives and amino alcohols, including potential solubility in polar solvents due to the presence of the dimethylamino group. It may participate in hydrogen bonding due to its carboxylic acid functionality, which can influence its reactivity and interaction with biological systems. The compound is likely to exhibit moderate stability under standard conditions but may be sensitive to changes in pH or temperature. Its unique structure suggests potential applications in pharmaceuticals or as a biochemical reagent, particularly in the synthesis of more complex molecules. However, specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature review for precise values.
Formula:C5H4N2O4·C4H11NO
InChI:InChI=1S/C5H4N2O4.C4H11NO/c8-3-1-2(4(9)10)6-5(11)7-3;1-5(2)3-4-6/h1H,(H,9,10)(H2,6,7,8,11);6H,3-4H2,1-2H3
InChI key:InChIKey=ROHGCLWGNSVXHD-UHFFFAOYSA-N
SMILES:C(N(C)C)CO.C(O)(=O)C1=CC(=O)NC(=O)N1
Synonyms:- Orotic acid, compd. with 2-(dimethylamino)ethanol
- Ethanol, 2-(dimethylamino)-, 1,2,3,4-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate (salt)
- Orotic acid, compd. with 2-(dimethylamino)ethanol (1:1)
- Ethanol, 2-(dimethylamino)-, orotate (salt)
- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, compd. with 2-(dimethylamino)ethanol (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, compd. with 2-(dimethylamino)ethanol (1:1)
CAS:Formula:C9H15N3O5Molecular weight:245.2325Deanol orotate
CAS:Deanol orotate is a biochemical.Formula:C9H15N3O5Color and Shape:SolidMolecular weight:245.23

