CAS 144602-02-8
:(3S)-3-[[(2S)-2-[[(2S)-2-[[(4S,10S,13R)-13-amino-4-benzyl-7-[(4-hydroxyphenyl)methyl]-10-isopropyl-3,6,9,12-tetraoxo-15,16-dithia-2,5,8,11-tetrazacycloheptadecane-1-carbonyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methyl-pentanoyl]amino]-4-[[(1S,2S)
Description:
The chemical substance with the name provided is a complex organic compound characterized by its intricate structure, which includes multiple amino acid residues and a bicyclic framework. It features a tetraoxo-tetrazacycloheptadecane core, indicating a significant degree of nitrogen and sulfur incorporation, which contributes to its unique properties. The presence of various functional groups, such as amines and hydroxyls, suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in pharmaceutical applications. The stereochemistry, indicated by the (S) and (R) designations, implies that the compound exhibits chirality, which can influence its biological activity and interaction with receptors. Additionally, the compound's molecular weight and solubility characteristics would be critical for its behavior in biological environments. Overall, this substance is likely to be studied for its potential therapeutic effects, particularly in the context of drug design and development, due to its structural complexity and functional diversity.
Formula:C68H92N14O15S2
InChI:InChI=1/C68H92N14O15S2/c1-9-37(7)56(66(94)78-52(68(96)97)27-41-30-71-46-19-15-14-18-44(41)46)82-67(95)57(38(8)10-2)81-63(91)51(29-54(84)85)76-59(87)47(24-35(3)4)73-62(90)50(28-42-31-70-34-72-42)75-64(92)53-33-99-98-32-45(69)58(86)80-55(36(5)6)65(93)77-49(26-40-20-22-43(83)23-21-40)60(88)74-48(61(89)79-53)25-39-16-12-11-13-17-39/h11-23,30-31,34-38,45,47-53,55-57,71,83H,9-10,24-29,32-33,69H2,1-8H3,(H,70,72)(H,73,90)(H,74,88)(H,75,92)(H,76,87)(H,77,93)(H,78,94)(H,79,89)(H,80,86)(H,81,91)(H,82,95)(H,84,85)(H,96,97)/t37-,38-,45-,47-,48-,49?,50-,51-,52-,53?,55-,56-,57-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)O)N=C([C@H]([C@@H](C)CC)N=C([C@H](CC(=O)O)N=C([C@H](CC(C)C)N=C([C@H](Cc1cnc[nH]1)N=C(C1CSSC[C@@H](C(=N[C@@H](C(C)C)C(=NC(Cc2ccc(cc2)O)C(=N[C@@H](Cc2ccccc2)C(=N1)O)O)O)O)N)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
IRL-1038
CAS:ETB endothelin receptor antagonistFormula:C68H92N14O15S2Purity:98%Color and Shape:SolidMolecular weight:1409.67Endothelin-1 (11-21) trifluoroacetate salt
CAS:Endothelin-1 (11-21) trifluoroacetate salt H-Cys-Val-Tyr-Phe-Cys-His-Leu-Asp-Ile-Ile-Trp is a peptide that is derived from endothelin. It has been shown to have an inhibitory effect on insulin stimulated glucose uptake in Sprague Dawley rats. This peptide has also been shown to bind to the endothelin receptor and act as a nonselective agonist. Endothelin 1 (11–21) trifluoroacetate salt H-Cys Val Tyr Phe Cys His Leu Asp Ile Ile Trp, when incubated with cells, had a maximal response at micron concentrations.Formula:C68H92N14O15S2Purity:Min. 95%Molecular weight:1,409.68 g/mol

