CAS 1446321-46-5
:2-Hydroxy-6-[[2-[1-(1-methylethyl)-1H-pyrazol-5-yl]-3-pyridinyl]methoxy]benzaldehyde
Description:
2-Hydroxy-6-[[2-[1-(1-methylethyl)-1H-pyrazol-5-yl]-3-pyridinyl]methoxy]benzaldehyde is a complex organic compound characterized by its unique structural features, which include a hydroxyl group, a benzaldehyde moiety, and a pyrazole-pyridine linkage. This compound is likely to exhibit properties typical of phenolic compounds, such as potential antioxidant activity, due to the presence of the hydroxyl group. The presence of the pyrazole and pyridine rings suggests that it may also exhibit biological activity, possibly interacting with various biological targets. Its molecular structure indicates that it could be soluble in organic solvents, and its reactivity may be influenced by the functional groups present. The compound's specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and stability. As with many organic compounds, its behavior in different environments, such as pH and temperature, would be essential for understanding its practical uses and safety profile.
Formula:C19H19N3O3
InChI:InChI=1S/C19H19N3O3/c1-13(2)22-16(8-10-21-22)19-14(5-4-9-20-19)12-25-18-7-3-6-17(24)15(18)11-23/h3-11,13,24H,12H2,1-2H3
InChI key:InChIKey=FWCVZAQENIZVMY-UHFFFAOYSA-N
SMILES:C(OC1=C(C=O)C(O)=CC=C1)C2=C(N=CC=C2)C=3N(C(C)C)N=CC3
Synonyms:- GBT 440
- 2-Hydroxy-6-[[2-[1-(1-methylethyl)-1H-pyrazol-5-yl]-3-pyridinyl]methoxy]benzaldehyde
- Benzaldehyde, 2-hydroxy-6-[[2-[1-(1-methylethyl)-1H-pyrazol-5-yl]-3-pyridinyl]methoxy]-
- 2-hydroxy-6-{[2-[1-(propan-2-yl)-1H-pyrazol-5-yl]pyridin-3-yl]methoxy}benzaldehyde
- Voxelotor
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Hemoglobin Modulators-1
CAS:Formula:C19H19N3O3Purity:98%Color and Shape:SolidMolecular weight:337.3725voxelotor
CAS:Voxelotor (GBT 440) is an orally novel hemoglobin S (HbS) polymerization inhibitor used for the treatment of sickle cell disease (SCD). Cost-effective and quality-assured.
Formula:C19H19N3O3Purity:99.9% - 99.94%Color and Shape:SolidMolecular weight:337.372-HYDROXY-6-((2-(1-ISOPROPYL-1H-PYRAZOL-5-YL)PYRIDIN-3-YL)METHOXY)BENZALDEHYDE
CAS:Purity:95.0%Molecular weight:337.3789978027344GBT 440
CAS:Applications GBT 440 is a potent allosteric effector of sickle cell hemoglobin (Hb) that increases the affinity of Hb for oxygen and inhibits its polymerization when subjected to hypoxic conditions.
References Metcalf, B., et al.: ACS Med. Chem., 8, 321-326 (2017); Li, Q., et al.: Proc. Natl. Acad. Sci. U.S.A., 114, E689-E696 (2017)Formula:C19H19N3O3Color and Shape:NeatMolecular weight:337.37Voxelotor
CAS:Controlled ProductVoxelotor is an oral therapeutic agent, which is a small molecule obtained through synthetic chemistry with targeted activity on hemoglobin. Its mode of action involves the allosteric modification of hemoglobin, specifically increasing hemoglobin oxygen affinity. By stabilizing the oxygenated hemoglobin state, voxelotor reduces the sickling and polymerization of red blood cells that are characteristic of sickle cell disease (SCD).Formula:C19H19N3O3Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:337.37 g/mol






