CAS 1446355-50-5
:7-Methyl-5-oxa-2,7-diazaspiro[3.4]octan-6-one
Description:
7-Methyl-5-oxa-2,7-diazaspiro[3.4]octan-6-one is a heterocyclic compound characterized by its unique spirocyclic structure, which consists of a fused ring system containing both nitrogen and oxygen atoms. The presence of the methyl group at the 7-position contributes to its chemical properties, potentially influencing its reactivity and solubility. The compound features a diaza configuration, indicating the presence of two nitrogen atoms within the ring structure, which can affect its basicity and potential interactions with other chemical species. The oxo group (C=O) at the 6-position suggests that it may exhibit ketone-like reactivity, making it a candidate for various chemical transformations. This compound may have applications in medicinal chemistry or materials science, although specific biological activities or uses would depend on further research. Its unique structural features may also allow for interesting interactions in biological systems, warranting investigation into its pharmacological properties. Overall, 7-Methyl-5-oxa-2,7-diazaspiro[3.4]octan-6-one represents a complex and potentially versatile chemical entity.
Formula:C6H10N2O2
InChI:InChI=1S/C6H10N2O2/c1-8-4-6(2-7-3-6)10-5(8)9/h7H,2-4H2,1H3
InChI key:InChIKey=RUNNPHJFVKWZFO-UHFFFAOYSA-N
SMILES:CN1CC2(OC1=O)CNC2
Synonyms:- 7-Methyl-5-oxa-2,7-diazaspiro[3.4]octan-6-one
- 5-Oxa-2,7-diazaspiro[3.4]octan-6-one, 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7-Methyl-5-oxa-2,7-diazaspiro[3.4]octan-6-one
CAS:Controlled ProductFormula:C6H10N2O2Color and Shape:NeatMolecular weight:142.156

